C12H8F2N2O2 — CID 86240717
3-(5,6-difluoro-1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 86240717) has the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. Its IUPAC name is 3-(5,6-difluoro-1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(5,6-difluoro-1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86240717 |
| Molecular Formula | C12H8F2N2O2 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-(5,6-difluoro-1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2c[nH]c3cc(F)c(F)cc23)C(=O)N1 |
| InChI | InChI=1S/C12H8F2N2O2/c13-8-1-5-7(4-15-10(5)3-9(8)14)6-2-11(17)16-12(6)18/h1,3-4,6,15H,2H2,(H,16,17,18) |
| InChIKey | ASSGNCUADIFTFP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|