C13H12N2O3 — CID 118520343
3-[5-(hydroxymethyl)-1H-indol-3-yl]pyrrolidine-2,5-dione (PubChem CID 118520343) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)-1H-indol-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-[5-(hydroxymethyl)-1H-indol-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118520343 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[5-(hydroxymethyl)-1H-indol-3-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2c[nH]c3ccc(CO)cc23)C(=O)N1 |
| InChI | InChI=1S/C13H12N2O3/c16-6-7-1-2-11-8(3-7)10(5-14-11)9-4-12(17)15-13(9)18/h1-3,5,9,14,16H,4,6H2,(H,15,17,18) |
| InChIKey | PIYZASGZELZCSC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|