C13H9N3O2 — CID 123229041
3-(5-isocyano-1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 123229041) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-(5-isocyano-1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(5-isocyano-1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 123229041 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(5-isocyano-1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(C3CC(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C13H9N3O2/c1-14-7-2-3-11-8(4-7)10(6-15-11)9-5-12(17)16-13(9)18/h2-4,6,9,15H,5H2,(H,16,17,18) |
| InChIKey | ZGNZUDNGNWWUEX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|