C17H21N3 — CID 58697553
1-[(1S,2S)-2-(5-isocyano-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine (PubChem CID 58697553) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(5-isocyano-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1S,2S)-2-(5-isocyano-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 58697553 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-[(1S,2S)-2-(5-isocyano-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine |
| SMILES | [C-]#[N+]c1ccc2[nH]cc([C@H]3CCC[C@@H]3CN(C)C)c2c1 |
| InChI | InChI=1S/C17H21N3/c1-18-13-7-8-17-15(9-13)16(10-19-17)14-6-4-5-12(14)11-20(2)3/h7-10,12,14,19H,4-6,11H2,2-3H3/t12-,14+/m1/s1 |
| InChIKey | JAHXAEBJKOKHQP-OCCSQVGLSA-N |
| XLogP | 4.16 |
| TPSA | 23.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|