C19H25N3 — CID 23519079
N,N-diethyl-3-[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]propan-1-amine (PubChem CID 23519079) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is N,N-diethyl-3-[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]propan-1-amine.
| Compound Name | N,N-diethyl-3-[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]propan-1-amine |
|---|---|
| PubChem CID | 23519079 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N,N-diethyl-3-[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]propan-1-amine |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(C3CC3CCCN(CC)CC)c2c1 |
| InChI | InChI=1S/C19H25N3/c1-4-22(5-2)10-6-7-14-11-16(14)18-13-21-19-9-8-15(20-3)12-17(18)19/h8-9,12-14,16,21H,4-7,10-11H2,1-2H3 |
| InChIKey | BHULNQHAEADZJF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 23.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|