C22H23N3 — CID 23519053
N-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl]-3-phenylpropan-1-amine (PubChem CID 23519053) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl]-3-phenylpropan-1-amine.
| Compound Name | N-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 23519053 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl]-3-phenylpropan-1-amine |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(C3CC3CNCCCc3ccccc3)c2c1 |
| InChI | InChI=1S/C22H23N3/c1-23-18-9-10-22-20(13-18)21(15-25-22)19-12-17(19)14-24-11-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-10,13,15,17,19,24-25H,5,8,11-12,14H2 |
| InChIKey | ZWAKTXIZWZBSNB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 32.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|