C14H15F3N2 — CID 142174206
N-methyl-1-[(2S)-2-[5-(trifluoromethyl)-1H-indol-3-yl]cyclopropyl]methanamine (PubChem CID 142174206) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-methyl-1-[(2S)-2-[5-(trifluoromethyl)-1H-indol-3-yl]cyclopropyl]methanamine.
| Compound Name | N-methyl-1-[(2S)-2-[5-(trifluoromethyl)-1H-indol-3-yl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 142174206 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-methyl-1-[(2S)-2-[5-(trifluoromethyl)-1H-indol-3-yl]cyclopropyl]methanamine |
| SMILES | CNCC1C[C@@H]1c1c[nH]c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H15F3N2/c1-18-6-8-4-10(8)12-7-19-13-3-2-9(5-11(12)13)14(15,16)17/h2-3,5,7-8,10,18-19H,4,6H2,1H3/t8?,10-/m0/s1 |
| InChIKey | DRTUCHUPWPGRTC-HTLJXXAVSA-N |
| XLogP | 3.51 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |