C15H23N — CID 124705421
N-[[(1R,2R)-2-phenylcyclopropyl]methyl]pentan-1-amine (PubChem CID 124705421) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-[[(1R,2R)-2-phenylcyclopropyl]methyl]pentan-1-amine.
| Compound Name | N-[[(1R,2R)-2-phenylcyclopropyl]methyl]pentan-1-amine |
|---|---|
| PubChem CID | 124705421 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-[[(1R,2R)-2-phenylcyclopropyl]methyl]pentan-1-amine |
| SMILES | CCCCCNC[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H23N/c1-2-3-7-10-16-12-14-11-15(14)13-8-5-4-6-9-13/h4-6,8-9,14-16H,2-3,7,10-12H2,1H3/t14-,15-/m0/s1 |
| InChIKey | WEJDLIVHIJVUKY-GJZGRUSLSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|