C20H28N4O2 — CID 158058751
ethyl N-[2-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate;methane (PubChem CID 158058751) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl N-[2-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate;methane.
| Compound Name | ethyl N-[2-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate;methane |
|---|---|
| PubChem CID | 158058751 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | ethyl N-[2-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]ethyl]carbamate;methane |
| SMILES | C.[C-]#[N+]c1ccc2[nH]cc(C3CC3CN(C)CCNC(=O)OCC)c2c1 |
| InChI | InChI=1S/C19H24N4O2.CH4/c1-4-25-19(24)21-7-8-23(3)12-13-9-15(13)17-11-22-18-6-5-14(20-2)10-16(17)18;/h5-6,10-11,13,15,22H,4,7-9,12H2,1,3H3,(H,21,24);1H4 |
| InChIKey | FKJQOLQJRJNXKT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|