C19H26FN3O2 — CID 23519023
methyl N-[3-[ethyl-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]amino]propyl]carbamate (PubChem CID 23519023) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is methyl N-[3-[ethyl-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]amino]propyl]carbamate.
| Compound Name | methyl N-[3-[ethyl-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 23519023 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | methyl N-[3-[ethyl-[[2-(5-fluoro-1H-indol-3-yl)cyclopropyl]methyl]amino]propyl]carbamate |
| SMILES | CCN(CCCNC(=O)OC)CC1CC1c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C19H26FN3O2/c1-3-23(8-4-7-21-19(24)25-2)12-13-9-15(13)17-11-22-18-6-5-14(20)10-16(17)18/h5-6,10-11,13,15,22H,3-4,7-9,12H2,1-2H3,(H,21,24) |
| InChIKey | AKTZGQHNZMUJET-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|