C21H28N4O2 — CID 23519015
propan-2-yl N-[3-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]propyl]carbamate (PubChem CID 23519015) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is propan-2-yl N-[3-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]propyl]carbamate.
| Compound Name | propan-2-yl N-[3-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 23519015 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | propan-2-yl N-[3-[[2-(5-isocyano-1H-indol-3-yl)cyclopropyl]methyl-methylamino]propyl]carbamate |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(C3CC3CN(C)CCCNC(=O)OC(C)C)c2c1 |
| InChI | InChI=1S/C21H28N4O2/c1-14(2)27-21(26)23-8-5-9-25(4)13-15-10-17(15)19-12-24-20-7-6-16(22-3)11-18(19)20/h6-7,11-12,14-15,17,24H,5,8-10,13H2,1-2,4H3,(H,23,26) |
| InChIKey | OWNNCNUUCUZXBY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|