C17H21N3 — CID 22638830
3-[2-[3-(ethylamino)propyl]cyclopropyl]-1H-indole-5-carbonitrile (PubChem CID 22638830) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-[2-[3-(ethylamino)propyl]cyclopropyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[2-[3-(ethylamino)propyl]cyclopropyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 22638830 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-[2-[3-(ethylamino)propyl]cyclopropyl]-1H-indole-5-carbonitrile |
| SMILES | CCNCCCC1CC1c1c[nH]c2ccc(C#N)cc12 |
| InChI | InChI=1S/C17H21N3/c1-2-19-7-3-4-13-9-14(13)16-11-20-17-6-5-12(10-18)8-15(16)17/h5-6,8,11,13-14,19-20H,2-4,7,9H2,1H3 |
| InChIKey | UABAWVMGMPTORM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|