C16H21IN2 — CID 86591648
1-[(1R,2R)-2-(5-iodo-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine (PubChem CID 86591648) has the molecular formula C16H21IN2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(5-iodo-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1R,2R)-2-(5-iodo-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 86591648 |
| Molecular Formula | C16H21IN2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-[(1R,2R)-2-(5-iodo-1H-indol-3-yl)cyclopentyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@@H]1CCC[C@H]1c1c[nH]c2ccc(I)cc12 |
| InChI | InChI=1S/C16H21IN2/c1-19(2)10-11-4-3-5-13(11)15-9-18-16-7-6-12(17)8-14(15)16/h6-9,11,13,18H,3-5,10H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | PJLQSSHKFDVULV-WCQYABFASA-N |
| XLogP | 4.22 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|