C14H17N3 — CID 156836179
3-[2-[ethyl(methyl)amino]ethyl]-1H-indole-6-carbonitrile (PubChem CID 156836179) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-[2-[ethyl(methyl)amino]ethyl]-1H-indole-6-carbonitrile.
| Compound Name | 3-[2-[ethyl(methyl)amino]ethyl]-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 156836179 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-[2-[ethyl(methyl)amino]ethyl]-1H-indole-6-carbonitrile |
| SMILES | CCN(C)CCc1c[nH]c2cc(C#N)ccc12 |
| InChI | InChI=1S/C14H17N3/c1-3-17(2)7-6-12-10-16-14-8-11(9-15)4-5-13(12)14/h4-5,8,10,16H,3,6-7H2,1-2H3 |
| InChIKey | AXIFDHADTYQZDR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |