C12H11N3O2 — CID 175555647
2-(6-cyano-1H-indol-3-yl)ethyl carbamate (PubChem CID 175555647) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(6-cyano-1H-indol-3-yl)ethyl carbamate.
| Compound Name | 2-(6-cyano-1H-indol-3-yl)ethyl carbamate |
|---|---|
| PubChem CID | 175555647 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(6-cyano-1H-indol-3-yl)ethyl carbamate |
| SMILES | N#Cc1ccc2c(CCOC(N)=O)c[nH]c2c1 |
| InChI | InChI=1S/C12H11N3O2/c13-6-8-1-2-10-9(3-4-17-12(14)16)7-15-11(10)5-8/h1-2,5,7,15H,3-4H2,(H2,14,16) |
| InChIKey | XTZTVTKVSMQPGJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |