C12H13ClN2O2 — CID 175327400
2-(6-chloro-1H-indol-3-yl)ethyl N-methylcarbamate (PubChem CID 175327400) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-(6-chloro-1H-indol-3-yl)ethyl N-methylcarbamate.
| Compound Name | 2-(6-chloro-1H-indol-3-yl)ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 175327400 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(6-chloro-1H-indol-3-yl)ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCc1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H13ClN2O2/c1-14-12(16)17-5-4-8-7-15-11-6-9(13)2-3-10(8)11/h2-3,6-7,15H,4-5H2,1H3,(H,14,16) |
| InChIKey | VPBXCLBIAWZAII-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |