C14H22N2O2S — CID 177026314
N-ethyl-N-methyl-2-(5-methylsulfonyl-1H-indol-3-yl)ethanamine;molecular hydrogen (PubChem CID 177026314) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-(5-methylsulfonyl-1H-indol-3-yl)ethanamine;molecular hydrogen.
| Compound Name | N-ethyl-N-methyl-2-(5-methylsulfonyl-1H-indol-3-yl)ethanamine;molecular hydrogen |
|---|---|
| PubChem CID | 177026314 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-ethyl-N-methyl-2-(5-methylsulfonyl-1H-indol-3-yl)ethanamine;molecular hydrogen |
| SMILES | CCN(C)CCc1c[nH]c2ccc(S(C)(=O)=O)cc12.[H][H] |
| InChI | InChI=1S/C14H20N2O2S.H2/c1-4-16(2)8-7-11-10-15-14-6-5-12(9-13(11)14)19(3,17)18;/h5-6,9-10,15H,4,7-8H2,1-3H3;1H |
| InChIKey | NFYRLXKWXSAGTP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |