C30H29F2N3O — CID 18382458
1-[3-[4-(5-fluoro-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile (PubChem CID 18382458) has the molecular formula C30H29F2N3O and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-[3-[4-(5-fluoro-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile.
| Compound Name | 1-[3-[4-(5-fluoro-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 18382458 |
| Molecular Formula | C30H29F2N3O |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 1-[3-[4-(5-fluoro-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)COC2(CCCNCCCCc1c[nH]c2ccc(F)cc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H29F2N3O/c31-25-8-6-24(7-9-25)30(28-11-5-21(18-33)16-23(28)20-36-30)13-3-15-34-14-2-1-4-22-19-35-29-12-10-26(32)17-27(22)29/h5-12,16-17,19,34-35H,1-4,13-15,20H2 |
| InChIKey | DQUJIVBVTWFMNG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|