C21H21F4NO4SSe — CID 158647530
3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethylselanium;trifluoromethanesulfonate (PubChem CID 158647530) has the molecular formula C21H21F4NO4SSe and a molecular weight of 538.42 g/mol. Its IUPAC name is 3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethylselanium;trifluoromethanesulfonate.
| Compound Name | 3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethylselanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158647530 |
| Molecular Formula | C21H21F4NO4SSe |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | 3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-dimethylselanium;trifluoromethanesulfonate |
| SMILES | C[Se+](C)CCC[C@@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H21FNOSe.CHF3O3S/c1-24(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-23-20;2-1(3,4)8(5,6)7/h4-9,12H,3,10-11,14H2,1-2H3;(H,5,6,7)/q+1;/p-1/t20-;/m0./s1 |
| InChIKey | IBDNUKBWRJLYIL-BDQAORGHSA-M |
| XLogP | 5.06 |
| TPSA | 90.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|