C20H19FN2O3 — CID 11210419
2-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propylamino]acetic acid (PubChem CID 11210419) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propylamino]acetic acid.
| Compound Name | 2-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propylamino]acetic acid |
|---|---|
| PubChem CID | 11210419 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propylamino]acetic acid |
| SMILES | N#Cc1ccc2c(c1)COC2(CCCNCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FN2O3/c21-17-5-3-16(4-6-17)20(8-1-9-23-12-19(24)25)18-7-2-14(11-22)10-15(18)13-26-20/h2-7,10,23H,1,8-9,12-13H2,(H,24,25) |
| InChIKey | UMOOSINNKYLLDU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|