C19H16FNO3 — CID 71587640
4-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]butanoic acid (PubChem CID 71587640) has the molecular formula C19H16FNO3 and a molecular weight of 325.34 g/mol. Its IUPAC name is 4-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]butanoic acid.
| Compound Name | 4-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]butanoic acid |
|---|---|
| PubChem CID | 71587640 |
| Molecular Formula | C19H16FNO3 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]butanoic acid |
| SMILES | N#Cc1ccc2c(c1)COC2(CCCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FNO3/c20-16-6-4-15(5-7-16)19(9-1-2-18(22)23)17-8-3-13(11-21)10-14(17)12-24-19/h3-8,10H,1-2,9,12H2,(H,22,23) |
| InChIKey | FOGQYQBNBJEREZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |