C19H20FN2O4P — CID 58600286
[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-methylamino]phosphonic acid (PubChem CID 58600286) has the molecular formula C19H20FN2O4P and a molecular weight of 390.35 g/mol. Its IUPAC name is [3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-methylamino]phosphonic acid.
| Compound Name | [3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-methylamino]phosphonic acid |
|---|---|
| PubChem CID | 58600286 |
| Molecular Formula | C19H20FN2O4P |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl-methylamino]phosphonic acid |
| SMILES | CN(CCCC1(c2ccc(F)cc2)OCc2cc(C#N)ccc21)P(=O)(O)O |
| InChI | InChI=1S/C19H20FN2O4P/c1-22(27(23,24)25)10-2-9-19(16-4-6-17(20)7-5-16)18-8-3-14(12-21)11-15(18)13-26-19/h3-8,11H,2,9-10,13H2,1H3,(H2,23,24,25) |
| InChIKey | SNALGJFBPDXURR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|