C30H29BrFN3O — CID 18382387
1-[3-[4-(5-bromo-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile (PubChem CID 18382387) has the molecular formula C30H29BrFN3O and a molecular weight of 546.48 g/mol. Its IUPAC name is 1-[3-[4-(5-bromo-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile.
| Compound Name | 1-[3-[4-(5-bromo-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 18382387 |
| Molecular Formula | C30H29BrFN3O |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 1-[3-[4-(5-bromo-1H-indol-3-yl)butylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)COC2(CCCNCCCCc1c[nH]c2ccc(Br)cc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H29BrFN3O/c31-25-8-12-29-27(17-25)22(19-35-29)4-1-2-14-34-15-3-13-30(24-6-9-26(32)10-7-24)28-11-5-21(18-33)16-23(28)20-36-30/h5-12,16-17,19,34-35H,1-4,13-15,20H2 |
| InChIKey | ZNQGZDIUDVRHNT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|