C28H30N2OS — CID 163968729
3-[3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxypropyl]-1H-indole-5-carbonitrile (PubChem CID 163968729) has the molecular formula C28H30N2OS and a molecular weight of 442.63 g/mol. Its IUPAC name is 3-[3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxypropyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxypropyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 163968729 |
| Molecular Formula | C28H30N2OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3-[3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxypropyl]-1H-indole-5-carbonitrile |
| SMILES | CC(C)(C)S(OCCCc1c[nH]c2ccc(C#N)cc12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2OS/c1-28(2,3)32(24-12-6-4-7-13-24,25-14-8-5-9-15-25)31-18-10-11-23-21-30-27-17-16-22(20-29)19-26(23)27/h4-9,12-17,19,21,30H,10-11,18H2,1-3H3 |
| InChIKey | SOCQHCBQNQTCOO-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|