About 3-bromo-4-butylphenol
3-bromo-4-butylphenol (PubChem CID 20571557) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 3-bromo-4-butylphenol.
Molecular Properties
| Compound Name | 3-bromo-4-butylphenol |
| PubChem CID | 20571557 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 3-bromo-4-butylphenol |
| SMILES | CCCCc1ccc(O)cc1Br |
| InChI | InChI=1S/C10H13BrO/c1-2-3-4-8-5-6-9(12)7-10(8)11/h5-7,12H,2-4H2,1H3 |
| InChIKey | SNQXWMYZQNPWEK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-4-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-butylphenol?
The IUPAC name of 3-bromo-4-butylphenol (CID 20571557) is 3-bromo-4-butylphenol.
What is the SMILES notation for 3-bromo-4-butylphenol?
The canonical SMILES for 3-bromo-4-butylphenol is CCCCc1ccc(O)cc1Br.
What is the InChIKey of 3-bromo-4-butylphenol?
The InChIKey is SNQXWMYZQNPWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO/c1-2-3-4-8-5-6-9(12)7-10(8)11/h5-7,12H,2-4H2,1H3.
What are the key properties of 3-bromo-4-butylphenol?
3-bromo-4-butylphenol has a molecular weight of 229.12 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-butylphenol is sourced from PubChem (CID 20571557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).