C24H34O4 — CID 134510319
3-[5-(2-butyl-5-hydroxyphenyl)-3,3-dimethoxypentyl]-4-methylphenol (PubChem CID 134510319) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 3-[5-(2-butyl-5-hydroxyphenyl)-3,3-dimethoxypentyl]-4-methylphenol.
| Compound Name | 3-[5-(2-butyl-5-hydroxyphenyl)-3,3-dimethoxypentyl]-4-methylphenol |
|---|---|
| PubChem CID | 134510319 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 3-[5-(2-butyl-5-hydroxyphenyl)-3,3-dimethoxypentyl]-4-methylphenol |
| SMILES | CCCCc1ccc(O)cc1CCC(CCc1cc(O)ccc1C)(OC)OC |
| InChI | InChI=1S/C24H34O4/c1-5-6-7-19-9-11-23(26)17-21(19)13-15-24(27-3,28-4)14-12-20-16-22(25)10-8-18(20)2/h8-11,16-17,25-26H,5-7,12-15H2,1-4H3 |
| InChIKey | SSPQHTDSAUSVTO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|