C26H30O4 — CID 134510264
3-[5-(5-hydroxy-2-phenylphenyl)-3,3-dimethoxypentyl]-4-methylphenol (PubChem CID 134510264) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is 3-[5-(5-hydroxy-2-phenylphenyl)-3,3-dimethoxypentyl]-4-methylphenol.
| Compound Name | 3-[5-(5-hydroxy-2-phenylphenyl)-3,3-dimethoxypentyl]-4-methylphenol |
|---|---|
| PubChem CID | 134510264 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 3-[5-(5-hydroxy-2-phenylphenyl)-3,3-dimethoxypentyl]-4-methylphenol |
| SMILES | COC(CCc1cc(O)ccc1C)(CCc1cc(O)ccc1-c1ccccc1)OC |
| InChI | InChI=1S/C26H30O4/c1-19-9-10-23(27)17-21(19)13-15-26(29-2,30-3)16-14-22-18-24(28)11-12-25(22)20-7-5-4-6-8-20/h4-12,17-18,27-28H,13-16H2,1-3H3 |
| InChIKey | NWVXNVBUGWDYHL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|