About butane;4-methylphenol;neodymium
butane;4-methylphenol;neodymium (PubChem CID 175187001) has the molecular formula C15H26NdO-2
and a molecular weight of 366.61 g/mol. Its IUPAC name is butane;4-methylphenol;neodymium.
Molecular Properties
| Compound Name | butane;4-methylphenol;neodymium |
| PubChem CID | 175187001 |
| Molecular Formula | C15H26NdO-2 |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | butane;4-methylphenol;neodymium |
| SMILES | Cc1ccc(O)cc1.[CH2-]CCC.[CH2-]CCC.[Nd] |
| InChI | InChI=1S/C7H8O.2C4H9.Nd/c1-6-2-4-7(8)5-3-6;2*1-3-4-2;/h2-5,8H,1H3;2*1,3-4H2,2H3;/q;2*-1; |
| InChIKey | CCFZZCLNEFWXKL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butane;4-methylphenol;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;4-methylphenol;neodymium?
The IUPAC name of butane;4-methylphenol;neodymium (CID 175187001) is butane;4-methylphenol;neodymium.
What is the SMILES notation for butane;4-methylphenol;neodymium?
The canonical SMILES for butane;4-methylphenol;neodymium is Cc1ccc(O)cc1.[CH2-]CCC.[CH2-]CCC.[Nd].
What is the InChIKey of butane;4-methylphenol;neodymium?
The InChIKey is CCFZZCLNEFWXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.2C4H9.Nd/c1-6-2-4-7(8)5-3-6;2*1-3-4-2;/h2-5,8H,1H3;2*1,3-4H2,2H3;/q;2*-1;.
What are the key properties of butane;4-methylphenol;neodymium?
butane;4-methylphenol;neodymium has a molecular weight of 366.61 g/mol, XLogP of 4.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;4-methylphenol;neodymium is sourced from PubChem (CID 175187001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).