About butane;2-methylbutane;4-methylphenol
butane;2-methylbutane;4-methylphenol (PubChem CID 155694307) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is butane;2-methylbutane;4-methylphenol.
Molecular Properties
| Compound Name | butane;2-methylbutane;4-methylphenol |
| PubChem CID | 155694307 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | butane;2-methylbutane;4-methylphenol |
| SMILES | CCC(C)C.CCCC.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C5H12.C4H10/c1-6-2-4-7(8)5-3-6;1-4-5(2)3;1-3-4-2/h2-5,8H,1H3;5H,4H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | JQBZRUUZWLIUAL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;2-methylbutane;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-methylbutane;4-methylphenol?
The IUPAC name of butane;2-methylbutane;4-methylphenol (CID 155694307) is butane;2-methylbutane;4-methylphenol.
What is the SMILES notation for butane;2-methylbutane;4-methylphenol?
The canonical SMILES for butane;2-methylbutane;4-methylphenol is CCC(C)C.CCCC.Cc1ccc(O)cc1.
What is the InChIKey of butane;2-methylbutane;4-methylphenol?
The InChIKey is JQBZRUUZWLIUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C5H12.C4H10/c1-6-2-4-7(8)5-3-6;1-4-5(2)3;1-3-4-2/h2-5,8H,1H3;5H,4H2,1-3H3;3-4H2,1-2H3.
What are the key properties of butane;2-methylbutane;4-methylphenol?
butane;2-methylbutane;4-methylphenol has a molecular weight of 238.41 g/mol, XLogP of 5.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-methylbutane;4-methylphenol is sourced from PubChem (CID 155694307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).