About butane;3-methylhexane;7-methylnaphthalen-2-ol
butane;3-methylhexane;7-methylnaphthalen-2-ol (PubChem CID 144963554) has the molecular formula C22H36O
and a molecular weight of 316.53 g/mol. Its IUPAC name is butane;3-methylhexane;7-methylnaphthalen-2-ol.
Molecular Properties
| Compound Name | butane;3-methylhexane;7-methylnaphthalen-2-ol |
| PubChem CID | 144963554 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | butane;3-methylhexane;7-methylnaphthalen-2-ol |
| SMILES | CCCC.CCCC(C)CC.Cc1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C11H10O.C7H16.C4H10/c1-8-2-3-9-4-5-11(12)7-10(9)6-8;1-4-6-7(3)5-2;1-3-4-2/h2-7,12H,1H3;7H,4-6H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | IWVRICNQJGPKAJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;3-methylhexane;7-methylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3-methylhexane;7-methylnaphthalen-2-ol?
The IUPAC name of butane;3-methylhexane;7-methylnaphthalen-2-ol (CID 144963554) is butane;3-methylhexane;7-methylnaphthalen-2-ol.
What is the SMILES notation for butane;3-methylhexane;7-methylnaphthalen-2-ol?
The canonical SMILES for butane;3-methylhexane;7-methylnaphthalen-2-ol is CCCC.CCCC(C)CC.Cc1ccc2ccc(O)cc2c1.
What is the InChIKey of butane;3-methylhexane;7-methylnaphthalen-2-ol?
The InChIKey is IWVRICNQJGPKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.C7H16.C4H10/c1-8-2-3-9-4-5-11(12)7-10(9)6-8;1-4-6-7(3)5-2;1-3-4-2/h2-7,12H,1H3;7H,4-6H2,1-3H3;3-4H2,1-2H3.
What are the key properties of butane;3-methylhexane;7-methylnaphthalen-2-ol?
butane;3-methylhexane;7-methylnaphthalen-2-ol has a molecular weight of 316.53 g/mol, XLogP of 7.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3-methylhexane;7-methylnaphthalen-2-ol is sourced from PubChem (CID 144963554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).