About 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol
2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol (PubChem CID 161075260) has the molecular formula C21H16Br2O
and a molecular weight of 444.17 g/mol. Its IUPAC name is 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol.
Molecular Properties
| Compound Name | 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol |
| PubChem CID | 161075260 |
| Molecular Formula | C21H16Br2O |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol |
| SMILES | Cc1ccc2cc(Br)ccc2c1.Oc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C11H9Br.C10H7BrO/c1-8-2-3-10-7-11(12)5-4-9(10)6-8;11-9-3-1-8-6-10(12)4-2-7(8)5-9/h2-7H,1H3;1-6,12H |
| InChIKey | UFELGFZBYNAWQS-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol?
The IUPAC name of 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol (CID 161075260) is 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol.
What is the SMILES notation for 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol?
The canonical SMILES for 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol is Cc1ccc2cc(Br)ccc2c1.Oc1ccc2cc(Br)ccc2c1.
What is the InChIKey of 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol?
The InChIKey is UFELGFZBYNAWQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br.C10H7BrO/c1-8-2-3-10-7-11(12)5-4-9(10)6-8;11-9-3-1-8-6-10(12)4-2-7(8)5-9/h2-7H,1H3;1-6,12H.
What are the key properties of 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol?
2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol has a molecular weight of 444.17 g/mol, XLogP of 7.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-methylnaphthalene;6-bromonaphthalen-2-ol is sourced from PubChem (CID 161075260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).