About 6-bromonaphthalen-2-ol;N-methylpropan-1-amine
6-bromonaphthalen-2-ol;N-methylpropan-1-amine (PubChem CID 123502448) has the molecular formula C14H18BrNO
and a molecular weight of 296.21 g/mol. Its IUPAC name is 6-bromonaphthalen-2-ol;N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 6-bromonaphthalen-2-ol;N-methylpropan-1-amine |
| PubChem CID | 123502448 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 6-bromonaphthalen-2-ol;N-methylpropan-1-amine |
| SMILES | CCCNC.Oc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C10H7BrO.C4H11N/c11-9-3-1-8-6-10(12)4-2-7(8)5-9;1-3-4-5-2/h1-6,12H;5H,3-4H2,1-2H3 |
| InChIKey | CUEKGUMLVJXBMG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromonaphthalen-2-ol;N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromonaphthalen-2-ol;N-methylpropan-1-amine?
The IUPAC name of 6-bromonaphthalen-2-ol;N-methylpropan-1-amine (CID 123502448) is 6-bromonaphthalen-2-ol;N-methylpropan-1-amine.
What is the SMILES notation for 6-bromonaphthalen-2-ol;N-methylpropan-1-amine?
The canonical SMILES for 6-bromonaphthalen-2-ol;N-methylpropan-1-amine is CCCNC.Oc1ccc2cc(Br)ccc2c1.
What is the InChIKey of 6-bromonaphthalen-2-ol;N-methylpropan-1-amine?
The InChIKey is CUEKGUMLVJXBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO.C4H11N/c11-9-3-1-8-6-10(12)4-2-7(8)5-9;1-3-4-5-2/h1-6,12H;5H,3-4H2,1-2H3.
What are the key properties of 6-bromonaphthalen-2-ol;N-methylpropan-1-amine?
6-bromonaphthalen-2-ol;N-methylpropan-1-amine has a molecular weight of 296.21 g/mol, XLogP of 3.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromonaphthalen-2-ol;N-methylpropan-1-amine is sourced from PubChem (CID 123502448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).