About ethane;6-propylnaphthalen-2-ol
ethane;6-propylnaphthalen-2-ol (PubChem CID 171088500) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethane;6-propylnaphthalen-2-ol.
Molecular Properties
| Compound Name | ethane;6-propylnaphthalen-2-ol |
| PubChem CID | 171088500 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethane;6-propylnaphthalen-2-ol |
| SMILES | CC.CCCc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C13H14O.C2H6/c1-2-3-10-4-5-12-9-13(14)7-6-11(12)8-10;1-2/h4-9,14H,2-3H2,1H3;1-2H3 |
| InChIKey | JFDPWFKUGOJLEV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-propylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-propylnaphthalen-2-ol?
The IUPAC name of ethane;6-propylnaphthalen-2-ol (CID 171088500) is ethane;6-propylnaphthalen-2-ol.
What is the SMILES notation for ethane;6-propylnaphthalen-2-ol?
The canonical SMILES for ethane;6-propylnaphthalen-2-ol is CC.CCCc1ccc2cc(O)ccc2c1.
What is the InChIKey of ethane;6-propylnaphthalen-2-ol?
The InChIKey is JFDPWFKUGOJLEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O.C2H6/c1-2-3-10-4-5-12-9-13(14)7-6-11(12)8-10;1-2/h4-9,14H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;6-propylnaphthalen-2-ol?
ethane;6-propylnaphthalen-2-ol has a molecular weight of 216.32 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-propylnaphthalen-2-ol is sourced from PubChem (CID 171088500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).