About 3,7-dipropylisoquinoline
3,7-dipropylisoquinoline (PubChem CID 135251714) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3,7-dipropylisoquinoline.
Molecular Properties
| Compound Name | 3,7-dipropylisoquinoline |
| PubChem CID | 135251714 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3,7-dipropylisoquinoline |
| SMILES | CCCc1ccc2cc(CCC)ncc2c1 |
| InChI | InChI=1S/C15H19N/c1-3-5-12-7-8-13-10-15(6-4-2)16-11-14(13)9-12/h7-11H,3-6H2,1-2H3 |
| InChIKey | NZYMFDAKSPHNSG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,7-dipropylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dipropylisoquinoline?
The IUPAC name of 3,7-dipropylisoquinoline (CID 135251714) is 3,7-dipropylisoquinoline.
What is the SMILES notation for 3,7-dipropylisoquinoline?
The canonical SMILES for 3,7-dipropylisoquinoline is CCCc1ccc2cc(CCC)ncc2c1.
What is the InChIKey of 3,7-dipropylisoquinoline?
The InChIKey is NZYMFDAKSPHNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c1-3-5-12-7-8-13-10-15(6-4-2)16-11-14(13)9-12/h7-11H,3-6H2,1-2H3.
What are the key properties of 3,7-dipropylisoquinoline?
3,7-dipropylisoquinoline has a molecular weight of 213.32 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dipropylisoquinoline is sourced from PubChem (CID 135251714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).