C44H34O6 — CID 101495595
1-[4-[4-[3,5-dimethyl-4-[4-(2-oxo-2-phenylacetyl)phenoxy]phenyl]-2,6-dimethylphenoxy]phenyl]-2-phenylethane-1,2-dione (PubChem CID 101495595) has the molecular formula C44H34O6 and a molecular weight of 658.75 g/mol. Its IUPAC name is 1-[4-[4-[3,5-dimethyl-4-[4-(2-oxo-2-phenylacetyl)phenoxy]phenyl]-2,6-dimethylphenoxy]phenyl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[4-[4-[3,5-dimethyl-4-[4-(2-oxo-2-phenylacetyl)phenoxy]phenyl]-2,6-dimethylphenoxy]phenyl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 101495595 |
| Molecular Formula | C44H34O6 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | 1-[4-[4-[3,5-dimethyl-4-[4-(2-oxo-2-phenylacetyl)phenoxy]phenyl]-2,6-dimethylphenoxy]phenyl]-2-phenylethane-1,2-dione |
| SMILES | Cc1cc(-c2cc(C)c(Oc3ccc(C(=O)C(=O)c4ccccc4)cc3)c(C)c2)cc(C)c1Oc1ccc(C(=O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H34O6/c1-27-23-35(24-28(2)43(27)49-37-19-15-33(16-20-37)41(47)39(45)31-11-7-5-8-12-31)36-25-29(3)44(30(4)26-36)50-38-21-17-34(18-22-38)42(48)40(46)32-13-9-6-10-14-32/h5-26H,1-4H3 |
| InChIKey | AAQFYTQOIYRXIE-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|