C25H24ClNO4 — CID 91119623
2-[4-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,5-dimethylphenyl]acetic acid (PubChem CID 91119623) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is 2-[4-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,5-dimethylphenyl]acetic acid.
| Compound Name | 2-[4-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,5-dimethylphenyl]acetic acid |
|---|---|
| PubChem CID | 91119623 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[4-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,5-dimethylphenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)cc(C)c1Oc1ccc(C(=O)N(Cl)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClNO4/c1-17-14-20(16-23(28)29)15-18(2)24(17)31-22-10-8-21(9-11-22)25(30)27(26)13-12-19-6-4-3-5-7-19/h3-11,14-15H,12-13,16H2,1-2H3,(H,28,29) |
| InChIKey | LIULGVUUWRQVIC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|