C25H23ClO4 — CID 146993998
2-[4-[4-[4-(4-chlorophenyl)butanoyl]phenoxy]-3-methylphenyl]acetic acid (PubChem CID 146993998) has the molecular formula C25H23ClO4 and a molecular weight of 422.91 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-chlorophenyl)butanoyl]phenoxy]-3-methylphenyl]acetic acid.
| Compound Name | 2-[4-[4-[4-(4-chlorophenyl)butanoyl]phenoxy]-3-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 146993998 |
| Molecular Formula | C25H23ClO4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[4-[4-[4-(4-chlorophenyl)butanoyl]phenoxy]-3-methylphenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)ccc1Oc1ccc(C(=O)CCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H23ClO4/c1-17-15-19(16-25(28)29)7-14-24(17)30-22-12-8-20(9-13-22)23(27)4-2-3-18-5-10-21(26)11-6-18/h5-15H,2-4,16H2,1H3,(H,28,29) |
| InChIKey | AQSSYBPDZHSZOE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |