C25H21Cl2NO5 — CID 123421774
5-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 123421774) has the molecular formula C25H21Cl2NO5 and a molecular weight of 486.35 g/mol. Its IUPAC name is 5-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid.
| Compound Name | 5-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
|---|---|
| PubChem CID | 123421774 |
| Molecular Formula | C25H21Cl2NO5 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 5-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | O=C(O)C1CCOc2cc(Oc3ccc(C(=O)N(Cl)CCc4ccccc4)cc3)cc(Cl)c21 |
| InChI | InChI=1S/C25H21Cl2NO5/c26-21-14-19(15-22-23(21)20(25(30)31)11-13-32-22)33-18-8-6-17(7-9-18)24(29)28(27)12-10-16-4-2-1-3-5-16/h1-9,14-15,20H,10-13H2,(H,30,31) |
| InChIKey | LIGCVKCVKRDLIQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|