C31H24Cl2NNaO6 — CID 87293652
sodium 6-chloro-7-[4-[(3-chlorophenoxy)-(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 87293652) has the molecular formula C31H24Cl2NNaO6 and a molecular weight of 600.43 g/mol. Its IUPAC name is sodium 6-chloro-7-[4-[(3-chlorophenoxy)-(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | sodium 6-chloro-7-[4-[(3-chlorophenoxy)-(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 87293652 |
| Molecular Formula | C31H24Cl2NNaO6 |
| Molecular Weight | 600.43 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | sodium 6-chloro-7-[4-[(3-chlorophenoxy)-(2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | O=C([O-])C1CCOc2cc(Oc3ccc(C(=O)N(CCc4ccccc4)Oc4cccc(Cl)c4)cc3)c(Cl)cc21.[Na+] |
| InChI | InChI=1S/C31H25Cl2NO6.Na/c32-22-7-4-8-24(17-22)40-34(15-13-20-5-2-1-3-6-20)30(35)21-9-11-23(12-10-21)39-29-19-28-26(18-27(29)33)25(31(36)37)14-16-38-28;/h1-12,17-19,25H,13-16H2,(H,36,37);/q;+1/p-1 |
| InChIKey | FRRKPFPUSOJZHX-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|