C26H20ClF3NNaO6 — CID 67080972
sodium 6-chloro-7-[4-[[2-phenyl-1-(trifluoromethoxy)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 67080972) has the molecular formula C26H20ClF3NNaO6 and a molecular weight of 557.88 g/mol. Its IUPAC name is sodium 6-chloro-7-[4-[[2-phenyl-1-(trifluoromethoxy)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | sodium 6-chloro-7-[4-[[2-phenyl-1-(trifluoromethoxy)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 67080972 |
| Molecular Formula | C26H20ClF3NNaO6 |
| Molecular Weight | 557.88 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | sodium 6-chloro-7-[4-[[2-phenyl-1-(trifluoromethoxy)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | O=C(NC(Cc1ccccc1)OC(F)(F)F)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)[O-])CCO3)cc1.[Na+] |
| InChI | InChI=1S/C26H21ClF3NO6.Na/c27-20-13-19-18(25(33)34)10-11-35-21(19)14-22(20)36-17-8-6-16(7-9-17)24(32)31-23(37-26(28,29)30)12-15-4-2-1-3-5-15;/h1-9,13-14,18,23H,10-12H2,(H,31,32)(H,33,34);/q;+1/p-1 |
| InChIKey | DCNYRMHNILDRMJ-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.88 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|