C27H26ClNO7 — CID 67080224
6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 67080224) has the molecular formula C27H26ClNO7 and a molecular weight of 511.96 g/mol. Its IUPAC name is 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid.
| Compound Name | 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
|---|---|
| PubChem CID | 67080224 |
| Molecular Formula | C27H26ClNO7 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | COc1ccc(CC(NC(=O)c2ccc(Oc3cc4c(cc3Cl)C(C(=O)O)CCO4)cc2)OC)cc1 |
| InChI | InChI=1S/C27H26ClNO7/c1-33-18-7-3-16(4-8-18)13-25(34-2)29-26(30)17-5-9-19(10-6-17)36-24-15-23-21(14-22(24)28)20(27(31)32)11-12-35-23/h3-10,14-15,20,25H,11-13H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | JIFATBOUPZJGDE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|