C25H20BrClNNaO5 — CID 67080467
sodium 7-[4-[(1-bromo-2-phenylethyl)carbamoyl]phenoxy]-6-chloro-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 67080467) has the molecular formula C25H20BrClNNaO5 and a molecular weight of 552.78 g/mol. Its IUPAC name is sodium 7-[4-[(1-bromo-2-phenylethyl)carbamoyl]phenoxy]-6-chloro-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | sodium 7-[4-[(1-bromo-2-phenylethyl)carbamoyl]phenoxy]-6-chloro-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 67080467 |
| Molecular Formula | C25H20BrClNNaO5 |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 551.01 |
| IUPAC Name | sodium 7-[4-[(1-bromo-2-phenylethyl)carbamoyl]phenoxy]-6-chloro-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | O=C(NC(Br)Cc1ccccc1)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)[O-])CCO3)cc1.[Na+] |
| InChI | InChI=1S/C25H21BrClNO5.Na/c26-23(12-15-4-2-1-3-5-15)28-24(29)16-6-8-17(9-7-16)33-22-14-21-19(13-20(22)27)18(25(30)31)10-11-32-21;/h1-9,13-14,18,23H,10-12H2,(H,28,29)(H,30,31);/q;+1/p-1 |
| InChIKey | SDJIUKMQOHANOS-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|