C25H20Cl2NNaO6 — CID 44600551
sodium 6-chloro-7-[4-[2-(2-chlorophenoxy)ethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 44600551) has the molecular formula C25H20Cl2NNaO6 and a molecular weight of 524.33 g/mol. Its IUPAC name is sodium 6-chloro-7-[4-[2-(2-chlorophenoxy)ethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | sodium 6-chloro-7-[4-[2-(2-chlorophenoxy)ethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 44600551 |
| Molecular Formula | C25H20Cl2NNaO6 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | sodium 6-chloro-7-[4-[2-(2-chlorophenoxy)ethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | O=C(NCCOc1ccccc1Cl)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)[O-])CCO3)cc1.[Na+] |
| InChI | InChI=1S/C25H21Cl2NO6.Na/c26-19-3-1-2-4-21(19)33-12-10-28-24(29)15-5-7-16(8-6-15)34-23-14-22-18(13-20(23)27)17(25(30)31)9-11-32-22;/h1-8,13-14,17H,9-12H2,(H,28,29)(H,30,31);/q;+1/p-1 |
| InChIKey | OKBBPLMOCXUKEM-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|