C31H25ClNNaO6 — CID 67080419
sodium 6-chloro-7-[4-[(1-phenoxy-2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 67080419) has the molecular formula C31H25ClNNaO6 and a molecular weight of 565.99 g/mol. Its IUPAC name is sodium 6-chloro-7-[4-[(1-phenoxy-2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | sodium 6-chloro-7-[4-[(1-phenoxy-2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 67080419 |
| Molecular Formula | C31H25ClNNaO6 |
| Molecular Weight | 565.99 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | sodium 6-chloro-7-[4-[(1-phenoxy-2-phenylethyl)carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | O=C(NC(Cc1ccccc1)Oc1ccccc1)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)[O-])CCO3)cc1.[Na+] |
| InChI | InChI=1S/C31H26ClNO6.Na/c32-26-18-25-24(31(35)36)15-16-37-27(25)19-28(26)38-23-13-11-21(12-14-23)30(34)33-29(17-20-7-3-1-4-8-20)39-22-9-5-2-6-10-22;/h1-14,18-19,24,29H,15-17H2,(H,33,34)(H,35,36);/q;+1/p-1 |
| InChIKey | YGZYKOGPJDHRJM-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.99 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|