C29H29ClNNaO6 — CID 67081035
sodium 6-chloro-7-[4-[[1-[(2-methylpropan-2-yl)oxy]-2-phenylethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 67081035) has the molecular formula C29H29ClNNaO6 and a molecular weight of 546.00 g/mol. Its IUPAC name is sodium 6-chloro-7-[4-[[1-[(2-methylpropan-2-yl)oxy]-2-phenylethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | sodium 6-chloro-7-[4-[[1-[(2-methylpropan-2-yl)oxy]-2-phenylethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 67081035 |
| Molecular Formula | C29H29ClNNaO6 |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | sodium 6-chloro-7-[4-[[1-[(2-methylpropan-2-yl)oxy]-2-phenylethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CC(C)(C)OC(Cc1ccccc1)NC(=O)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)[O-])CCO3)cc1.[Na+] |
| InChI | InChI=1S/C29H30ClNO6.Na/c1-29(2,3)37-26(15-18-7-5-4-6-8-18)31-27(32)19-9-11-20(12-10-19)36-25-17-24-22(16-23(25)30)21(28(33)34)13-14-35-24;/h4-12,16-17,21,26H,13-15H2,1-3H3,(H,31,32)(H,33,34);/q;+1/p-1 |
| InChIKey | QYKIMHQRIGPVIB-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|