C29H30ClNO7 — CID 67080842
ethyl 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 67080842) has the molecular formula C29H30ClNO7 and a molecular weight of 540.01 g/mol. Its IUPAC name is ethyl 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | ethyl 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 67080842 |
| Molecular Formula | C29H30ClNO7 |
| Molecular Weight | 540.01 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | ethyl 6-chloro-7-[4-[[1-methoxy-2-(4-methoxyphenyl)ethyl]carbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CCOC(=O)C1CCOc2cc(Oc3ccc(C(=O)NC(Cc4ccc(OC)cc4)OC)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C29H30ClNO7/c1-4-36-29(33)22-13-14-37-25-17-26(24(30)16-23(22)25)38-21-11-7-19(8-12-21)28(32)31-27(35-3)15-18-5-9-20(34-2)10-6-18/h5-12,16-17,22,27H,4,13-15H2,1-3H3,(H,31,32) |
| InChIKey | JGUVODSTZZGWFS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|