C27H25Cl2NO5S — CID 67080421
ethyl 6-chloro-7-[4-[2-(4-chlorophenyl)sulfanylethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 67080421) has the molecular formula C27H25Cl2NO5S and a molecular weight of 546.47 g/mol. Its IUPAC name is ethyl 6-chloro-7-[4-[2-(4-chlorophenyl)sulfanylethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | ethyl 6-chloro-7-[4-[2-(4-chlorophenyl)sulfanylethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 67080421 |
| Molecular Formula | C27H25Cl2NO5S |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | ethyl 6-chloro-7-[4-[2-(4-chlorophenyl)sulfanylethylcarbamoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CCOC(=O)C1CCOc2cc(Oc3ccc(C(=O)NCCSc4ccc(Cl)cc4)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C27H25Cl2NO5S/c1-2-33-27(32)21-11-13-34-24-16-25(23(29)15-22(21)24)35-19-7-3-17(4-8-19)26(31)30-12-14-36-20-9-5-18(28)6-10-20/h3-10,15-16,21H,2,11-14H2,1H3,(H,30,31) |
| InChIKey | PQCPDXDYZOTTIZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|