C26H22Cl2N2O7 — CID 90739050
methyl 6-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]-2-nitrophenoxy]-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 90739050) has the molecular formula C26H22Cl2N2O7 and a molecular weight of 545.38 g/mol. Its IUPAC name is methyl 6-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]-2-nitrophenoxy]-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | methyl 6-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]-2-nitrophenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 90739050 |
| Molecular Formula | C26H22Cl2N2O7 |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | methyl 6-chloro-7-[4-[chloro(2-phenylethyl)carbamoyl]-2-nitrophenoxy]-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | COC(=O)C1CCOc2cc(Oc3ccc(C(=O)N(Cl)CCc4ccccc4)cc3[N+](=O)[O-])c(Cl)cc21 |
| InChI | InChI=1S/C26H22Cl2N2O7/c1-35-26(32)18-10-12-36-23-15-24(20(27)14-19(18)23)37-22-8-7-17(13-21(22)30(33)34)25(31)29(28)11-9-16-5-3-2-4-6-16/h2-8,13-15,18H,9-12H2,1H3 |
| InChIKey | OBQYNTYBOUZQTQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|