C45H42N2O4 — CID 122365396
ethyl N-[4-[4-[2-[4-[4-[[ethoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate (PubChem CID 122365396) has the molecular formula C45H42N2O4 and a molecular weight of 674.84 g/mol. Its IUPAC name is ethyl N-[4-[4-[2-[4-[4-[[ethoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate.
| Compound Name | ethyl N-[4-[4-[2-[4-[4-[[ethoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 122365396 |
| Molecular Formula | C45H42N2O4 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | ethyl N-[4-[4-[2-[4-[4-[[ethoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate |
| SMILES | CCO/C(=N\c1ccc(Oc2ccc(C(C)(C)c3ccc(Oc4ccc(/N=C(\OCC)c5ccccc5)cc4)cc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H42N2O4/c1-5-48-43(33-13-9-7-10-14-33)46-37-21-29-41(30-22-37)50-39-25-17-35(18-26-39)45(3,4)36-19-27-40(28-20-36)51-42-31-23-38(24-32-42)47-44(49-6-2)34-15-11-8-12-16-34/h7-32H,5-6H2,1-4H3/b46-43-,47-44- |
| InChIKey | IESFPJNQCKEAKH-ACPYOCRUSA-N |
| XLogP | 11.83 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|