C35H38N2O4 — CID 122577844
ethyl N-[4-[4-[2-[4-[4-(1-ethoxyethylideneamino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]ethanimidate (PubChem CID 122577844) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is ethyl N-[4-[4-[2-[4-[4-(1-ethoxyethylideneamino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]ethanimidate.
| Compound Name | ethyl N-[4-[4-[2-[4-[4-(1-ethoxyethylideneamino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]ethanimidate |
|---|---|
| PubChem CID | 122577844 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | ethyl N-[4-[4-[2-[4-[4-(1-ethoxyethylideneamino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]ethanimidate |
| SMILES | CCO/C(C)=N/c1ccc(Oc2ccc(C(C)(C)c3ccc(Oc4ccc(/N=C(\C)OCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O4/c1-7-38-25(3)36-29-13-21-33(22-14-29)40-31-17-9-27(10-18-31)35(5,6)28-11-19-32(20-12-28)41-34-23-15-30(16-24-34)37-26(4)39-8-2/h9-24H,7-8H2,1-6H3/b36-25+,37-26+ |
| InChIKey | LZECPXVTNHFIBC-YEXGBYCNSA-N |
| XLogP | 9.77 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|